About antimony(3+);2-hydroxyethanethiolate;2-sulfidoethanolate
antimony(3+);2-hydroxyethanethiolate;2-sulfidoethanolate (PubChem CID 101332020) has the molecular formula C4H9O2S2Sb
and a molecular weight of 275.01 g/mol. Its IUPAC name is antimony(3+);2-hydroxyethanethiolate;2-sulfidoethanolate.
Molecular Properties
| Compound Name | antimony(3+);2-hydroxyethanethiolate;2-sulfidoethanolate |
| PubChem CID | 101332020 |
| Molecular Formula | C4H9O2S2Sb |
| Molecular Weight | 275.01 g/mol |
| Exact Mass | 273.91 |
| IUPAC Name | antimony(3+);2-hydroxyethanethiolate;2-sulfidoethanolate |
| SMILES | OCC[S-].[O-]CC[S-].[Sb+3] |
| InChI | InChI=1S/C2H6OS.C2H5OS.Sb/c2*3-1-2-4;/h3-4H,1-2H2;4H,1-2H2;/q;-1;+3/p-2 |
| InChIKey | UXLPASPDTIQGLQ-UHFFFAOYSA-L |
| XLogP | -1.96 |
| TPSA | 43.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.01 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze antimony(3+);2-hydroxyethanethiolate;2-sulfidoethanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of antimony(3+);2-hydroxyethanethiolate;2-sulfidoethanolate?
The IUPAC name of antimony(3+);2-hydroxyethanethiolate;2-sulfidoethanolate (CID 101332020) is antimony(3+);2-hydroxyethanethiolate;2-sulfidoethanolate.
What is the SMILES notation for antimony(3+);2-hydroxyethanethiolate;2-sulfidoethanolate?
The canonical SMILES for antimony(3+);2-hydroxyethanethiolate;2-sulfidoethanolate is OCC[S-].[O-]CC[S-].[Sb+3].
What is the InChIKey of antimony(3+);2-hydroxyethanethiolate;2-sulfidoethanolate?
The InChIKey is UXLPASPDTIQGLQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H6OS.C2H5OS.Sb/c2*3-1-2-4;/h3-4H,1-2H2;4H,1-2H2;/q;-1;+3/p-2.
What are the key properties of antimony(3+);2-hydroxyethanethiolate;2-sulfidoethanolate?
antimony(3+);2-hydroxyethanethiolate;2-sulfidoethanolate has a molecular weight of 275.01 g/mol, XLogP of -1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for antimony(3+);2-hydroxyethanethiolate;2-sulfidoethanolate is sourced from PubChem (CID 101332020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).