C14H31ClN2Si2 — CID 101332210
(1,3-ditert-butyl-2-chloro-1,3,2-diazasilol-2-yl)methyl-trimethylsilane (PubChem CID 101332210) has the molecular formula C14H31ClN2Si2 and a molecular weight of 319.04 g/mol. Its IUPAC name is (1,3-ditert-butyl-2-chloro-1,3,2-diazasilol-2-yl)methyl-trimethylsilane.
| Compound Name | (1,3-ditert-butyl-2-chloro-1,3,2-diazasilol-2-yl)methyl-trimethylsilane |
|---|---|
| PubChem CID | 101332210 |
| Molecular Formula | C14H31ClN2Si2 |
| Molecular Weight | 319.04 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (1,3-ditert-butyl-2-chloro-1,3,2-diazasilol-2-yl)methyl-trimethylsilane |
| SMILES | CC(C)(C)N1C=CN(C(C)(C)C)[Si]1(Cl)C[Si](C)(C)C |
| InChI | InChI=1S/C14H31ClN2Si2/c1-13(2,3)16-10-11-17(14(4,5)6)19(16,15)12-18(7,8)9/h10-11H,12H2,1-9H3 |
| InChIKey | RFLCNQJZBDPDAF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.04 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|