C11H14N2O3 — CID 101332360
N-[(3aR,4S,7aR)-6-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]acetamide (PubChem CID 101332360) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is N-[(3aR,4S,7aR)-6-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]acetamide.
| Compound Name | N-[(3aR,4S,7aR)-6-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]acetamide |
|---|---|
| PubChem CID | 101332360 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | N-[(3aR,4S,7aR)-6-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C=C(C)C[C@H]2C(=O)NC(=O)[C@@H]12 |
| InChI | InChI=1S/C11H14N2O3/c1-5-3-7-9(11(16)13-10(7)15)8(4-5)12-6(2)14/h4,7-9H,3H2,1-2H3,(H,12,14)(H,13,15,16)/t7-,8+,9-/m1/s1 |
| InChIKey | FRPMDVNBJYVLPO-HRDYMLBCSA-N |
| XLogP | -0.27 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|