C11H16N2O — CID 101332364
N-[(1R,4S,6R)-6-cyano-2,4-dimethylcyclohex-2-en-1-yl]acetamide (PubChem CID 101332364) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is N-[(1R,4S,6R)-6-cyano-2,4-dimethylcyclohex-2-en-1-yl]acetamide.
| Compound Name | N-[(1R,4S,6R)-6-cyano-2,4-dimethylcyclohex-2-en-1-yl]acetamide |
|---|---|
| PubChem CID | 101332364 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | N-[(1R,4S,6R)-6-cyano-2,4-dimethylcyclohex-2-en-1-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C(C)=C[C@@H](C)C[C@H]1C#N |
| InChI | InChI=1S/C11H16N2O/c1-7-4-8(2)11(13-9(3)14)10(5-7)6-12/h4,7,10-11H,5H2,1-3H3,(H,13,14)/t7-,10+,11+/m1/s1 |
| InChIKey | UVXDHHUKEZEUTQ-GGVZMXCHSA-N |
| XLogP | 1.62 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|