About methyl 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoate
methyl 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoate (PubChem CID 10133282) has the molecular formula C18H34O5S
and a molecular weight of 362.53 g/mol. Its IUPAC name is methyl 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoate.
Molecular Properties
| Compound Name | methyl 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoate |
| PubChem CID | 10133282 |
| Molecular Formula | C18H34O5S |
| Molecular Weight | 362.53 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | methyl 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoate |
| SMILES | COC(=O)C(C)(C)CCCCS(=O)CCCCC(C)(C)C(=O)OC |
| InChI | InChI=1S/C18H34O5S/c1-17(2,15(19)22-5)11-7-9-13-24(21)14-10-8-12-18(3,4)16(20)23-6/h7-14H2,1-6H3 |
| InChIKey | DIMOBBDWUYFCPA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoate?
The IUPAC name of methyl 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoate (CID 10133282) is methyl 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoate.
What is the SMILES notation for methyl 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoate?
The canonical SMILES for methyl 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoate is COC(=O)C(C)(C)CCCCS(=O)CCCCC(C)(C)C(=O)OC.
What is the InChIKey of methyl 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoate?
The InChIKey is DIMOBBDWUYFCPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O5S/c1-17(2,15(19)22-5)11-7-9-13-24(21)14-10-8-12-18(3,4)16(20)23-6/h7-14H2,1-6H3.
What are the key properties of methyl 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoate?
methyl 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoate has a molecular weight of 362.53 g/mol, XLogP of 3.47, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoate is sourced from PubChem (CID 10133282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).