C14H19NO2 — CID 101333144
ethyl (E,2R)-2-amino-2-methyl-5-phenylpent-4-enoate (PubChem CID 101333144) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is ethyl (E,2R)-2-amino-2-methyl-5-phenylpent-4-enoate.
| Compound Name | ethyl (E,2R)-2-amino-2-methyl-5-phenylpent-4-enoate |
|---|---|
| PubChem CID | 101333144 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | ethyl (E,2R)-2-amino-2-methyl-5-phenylpent-4-enoate |
| SMILES | CCOC(=O)[C@](C)(N)C/C=C/c1ccccc1 |
| InChI | InChI=1S/C14H19NO2/c1-3-17-13(16)14(2,15)11-7-10-12-8-5-4-6-9-12/h4-10H,3,11,15H2,1-2H3/b10-7+/t14-/m1/s1 |
| InChIKey | HPYRKDSBMREPBG-DNGMOHDESA-N |
| XLogP | 2.37 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |