C24H33NO6Si — CID 101333387
(1R)-1-[(4R,5R)-2,2-ditert-butyl-5-hydroxy-1,3,2-dioxasilinan-4-yl]-4-(4-methoxyphenyl)-1,5-dihydrofuro[3,4-c]pyrrol-3-one (PubChem CID 101333387) has the molecular formula C24H33NO6Si and a molecular weight of 459.62 g/mol. Its IUPAC name is (1R)-1-[(4R,5R)-2,2-ditert-butyl-5-hydroxy-1,3,2-dioxasilinan-4-yl]-4-(4-methoxyphenyl)-1,5-dihydrofuro[3,4-c]pyrrol-3-one.
| Compound Name | (1R)-1-[(4R,5R)-2,2-ditert-butyl-5-hydroxy-1,3,2-dioxasilinan-4-yl]-4-(4-methoxyphenyl)-1,5-dihydrofuro[3,4-c]pyrrol-3-one |
|---|---|
| PubChem CID | 101333387 |
| Molecular Formula | C24H33NO6Si |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | (1R)-1-[(4R,5R)-2,2-ditert-butyl-5-hydroxy-1,3,2-dioxasilinan-4-yl]-4-(4-methoxyphenyl)-1,5-dihydrofuro[3,4-c]pyrrol-3-one |
| SMILES | COc1ccc(-c2[nH]cc3c2C(=O)O[C@H]3[C@@H]2O[Si](C(C)(C)C)(C(C)(C)C)OC[C@H]2O)cc1 |
| InChI | InChI=1S/C24H33NO6Si/c1-23(2,3)32(24(4,5)6)29-13-17(26)21(31-32)20-16-12-25-19(18(16)22(27)30-20)14-8-10-15(28-7)11-9-14/h8-12,17,20-21,25-26H,13H2,1-7H3/t17-,20-,21-/m1/s1 |
| InChIKey | XGPYQMYLDUTNDG-DUXKGJEZSA-N |
| XLogP | 4.72 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|