C34H36O4Si — CID 101333427
3,9,15,21,26,26-hexamethyl-25,27-dioxa-26-silahexacyclo[21.5.1.17,11.113,17.05,28.019,24]hentriaconta-1,3,5(28),7,9,11(31),13(30),14,16,19(24),20,22-dodecaene-30,31-diol (PubChem CID 101333427) has the molecular formula C34H36O4Si and a molecular weight of 536.74 g/mol. Its IUPAC name is 3,9,15,21,26,26-hexamethyl-25,27-dioxa-26-silahexacyclo[21.5.1.17,11.113,17.05,28.019,24]hentriaconta-1,3,5(28),7,9,11(31),13(30),14,16,19(24),20,22-dodecaene-30,31-diol.
| Compound Name | 3,9,15,21,26,26-hexamethyl-25,27-dioxa-26-silahexacyclo[21.5.1.17,11.113,17.05,28.019,24]hentriaconta-1,3,5(28),7,9,11(31),13(30),14,16,19(24),20,22-dodecaene-30,31-diol |
|---|---|
| PubChem CID | 101333427 |
| Molecular Formula | C34H36O4Si |
| Molecular Weight | 536.74 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | 3,9,15,21,26,26-hexamethyl-25,27-dioxa-26-silahexacyclo[21.5.1.17,11.113,17.05,28.019,24]hentriaconta-1,3,5(28),7,9,11(31),13(30),14,16,19(24),20,22-dodecaene-30,31-diol |
| SMILES | Cc1cc2c(O)c(c1)Cc1cc(C)cc3c1O[Si](C)(C)Oc1c(cc(C)cc1C3)Cc1cc(C)cc(c1O)C2 |
| InChI | InChI=1S/C34H36O4Si/c1-19-7-23-15-24-8-20(2)10-26(32(24)36)17-28-12-22(4)14-30-18-29-13-21(3)11-27(16-25(9-19)31(23)35)33(29)37-39(5,6)38-34(28)30/h7-14,35-36H,15-18H2,1-6H3 |
| InChIKey | GFYRZLOXTRIQGF-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.74 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|