About 1-[2-(2-oxo-3H-1,3,4-oxadiazol-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea
1-[2-(2-oxo-3H-1,3,4-oxadiazol-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 10133353) has the molecular formula C16H11F3N4O3
and a molecular weight of 364.28 g/mol. Its IUPAC name is 1-[2-(2-oxo-3H-1,3,4-oxadiazol-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
Molecular Properties
| Compound Name | 1-[2-(2-oxo-3H-1,3,4-oxadiazol-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| PubChem CID | 10133353 |
| Molecular Formula | C16H11F3N4O3 |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 1-[2-(2-oxo-3H-1,3,4-oxadiazol-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)Nc1ccccc1-c1n[nH]c(=O)o1 |
| InChI | InChI=1S/C16H11F3N4O3/c17-16(18,19)9-4-3-5-10(8-9)20-14(24)21-12-7-2-1-6-11(12)13-22-23-15(25)26-13/h1-8H,(H,23,25)(H2,20,21,24) |
| InChIKey | NXPOAVPTRGRBAM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(2-oxo-3H-1,3,4-oxadiazol-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2-oxo-3H-1,3,4-oxadiazol-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea?
The IUPAC name of 1-[2-(2-oxo-3H-1,3,4-oxadiazol-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea (CID 10133353) is 1-[2-(2-oxo-3H-1,3,4-oxadiazol-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
What is the SMILES notation for 1-[2-(2-oxo-3H-1,3,4-oxadiazol-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea?
The canonical SMILES for 1-[2-(2-oxo-3H-1,3,4-oxadiazol-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea is O=C(Nc1cccc(C(F)(F)F)c1)Nc1ccccc1-c1n[nH]c(=O)o1.
What is the InChIKey of 1-[2-(2-oxo-3H-1,3,4-oxadiazol-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea?
The InChIKey is NXPOAVPTRGRBAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11F3N4O3/c17-16(18,19)9-4-3-5-10(8-9)20-14(24)21-12-7-2-1-6-11(12)13-22-23-15(25)26-13/h1-8H,(H,23,25)(H2,20,21,24).
What are the key properties of 1-[2-(2-oxo-3H-1,3,4-oxadiazol-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea?
1-[2-(2-oxo-3H-1,3,4-oxadiazol-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea has a molecular weight of 364.28 g/mol, XLogP of 3.69, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2-oxo-3H-1,3,4-oxadiazol-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea is sourced from PubChem (CID 10133353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).