C18H18F2N2O2S — CID 10133373
2-[5-(3-(19F)fluoro-5-fluorophenyl)sulfonyl-1,2-dimethylindol-3-yl]ethanamine (PubChem CID 10133373) has the molecular formula C18H18F2N2O2S and a molecular weight of 364.42 g/mol. Its IUPAC name is 2-[5-(3-(19F)fluoro-5-fluorophenyl)sulfonyl-1,2-dimethylindol-3-yl]ethanamine.
| Compound Name | 2-[5-(3-(19F)fluoro-5-fluorophenyl)sulfonyl-1,2-dimethylindol-3-yl]ethanamine |
|---|---|
| PubChem CID | 10133373 |
| Molecular Formula | C18H18F2N2O2S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-[5-(3-(19F)fluoro-5-fluorophenyl)sulfonyl-1,2-dimethylindol-3-yl]ethanamine |
| SMILES | Cc1c(CCN)c2cc(S(=O)(=O)c3cc(F)cc([19F])c3)ccc2n1C |
| InChI | InChI=1S/C18H18F2N2O2S/c1-11-16(5-6-21)17-10-14(3-4-18(17)22(11)2)25(23,24)15-8-12(19)7-13(20)9-15/h3-4,7-10H,5-6,21H2,1-2H3/i19+0 |
| InChIKey | RQBLNPUMXBCFNO-VGMNFMIGSA-N |
| XLogP | 3.10 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|