About 2-(2-hydroxy-2,2-diphenylethyl)-1H-quinazoline-4-thione
2-(2-hydroxy-2,2-diphenylethyl)-1H-quinazoline-4-thione (PubChem CID 101333730) has the molecular formula C22H18N2OS
and a molecular weight of 358.47 g/mol. Its IUPAC name is 2-(2-hydroxy-2,2-diphenylethyl)-1H-quinazoline-4-thione.
Molecular Properties
| Compound Name | 2-(2-hydroxy-2,2-diphenylethyl)-1H-quinazoline-4-thione |
| PubChem CID | 101333730 |
| Molecular Formula | C22H18N2OS |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-(2-hydroxy-2,2-diphenylethyl)-1H-quinazoline-4-thione |
| SMILES | OC(Cc1nc(=S)c2ccccc2[nH]1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H18N2OS/c25-22(16-9-3-1-4-10-16,17-11-5-2-6-12-17)15-20-23-19-14-8-7-13-18(19)21(26)24-20/h1-14,25H,15H2,(H,23,24,26) |
| InChIKey | LLIHZUSSGOLEQP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxy-2,2-diphenylethyl)-1H-quinazoline-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxy-2,2-diphenylethyl)-1H-quinazoline-4-thione?
The IUPAC name of 2-(2-hydroxy-2,2-diphenylethyl)-1H-quinazoline-4-thione (CID 101333730) is 2-(2-hydroxy-2,2-diphenylethyl)-1H-quinazoline-4-thione.
What is the SMILES notation for 2-(2-hydroxy-2,2-diphenylethyl)-1H-quinazoline-4-thione?
The canonical SMILES for 2-(2-hydroxy-2,2-diphenylethyl)-1H-quinazoline-4-thione is OC(Cc1nc(=S)c2ccccc2[nH]1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(2-hydroxy-2,2-diphenylethyl)-1H-quinazoline-4-thione?
The InChIKey is LLIHZUSSGOLEQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2OS/c25-22(16-9-3-1-4-10-16,17-11-5-2-6-12-17)15-20-23-19-14-8-7-13-18(19)21(26)24-20/h1-14,25H,15H2,(H,23,24,26).
What are the key properties of 2-(2-hydroxy-2,2-diphenylethyl)-1H-quinazoline-4-thione?
2-(2-hydroxy-2,2-diphenylethyl)-1H-quinazoline-4-thione has a molecular weight of 358.47 g/mol, XLogP of 4.77, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxy-2,2-diphenylethyl)-1H-quinazoline-4-thione is sourced from PubChem (CID 101333730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).