C19H28N2O5 — CID 10133385
1-benzyl-3-ethyl-1-[(6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methyl]urea (PubChem CID 10133385) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is 1-benzyl-3-ethyl-1-[(6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methyl]urea.
| Compound Name | 1-benzyl-3-ethyl-1-[(6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methyl]urea |
|---|---|
| PubChem CID | 10133385 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 1-benzyl-3-ethyl-1-[(6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methyl]urea |
| SMILES | CCNC(=O)N(Cc1ccccc1)CC1OC2OC(C)(C)OC2C1OC |
| InChI | InChI=1S/C19H28N2O5/c1-5-20-18(22)21(11-13-9-7-6-8-10-13)12-14-15(23-4)16-17(24-14)26-19(2,3)25-16/h6-10,14-17H,5,11-12H2,1-4H3,(H,20,22) |
| InChIKey | XEZUPJIMZDZRRQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |