C17H28O2Si — CID 101334118
(1S,8S,12S)-5-triethylsilyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,6-dien-1-ol (PubChem CID 101334118) has the molecular formula C17H28O2Si and a molecular weight of 292.50 g/mol. Its IUPAC name is (1S,8S,12S)-5-triethylsilyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,6-dien-1-ol.
| Compound Name | (1S,8S,12S)-5-triethylsilyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,6-dien-1-ol |
|---|---|
| PubChem CID | 101334118 |
| Molecular Formula | C17H28O2Si |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (1S,8S,12S)-5-triethylsilyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,6-dien-1-ol |
| SMILES | CC[Si](CC)(CC)C1=C2CO[C@@]3(O)CCC[C@@H](C=C1)[C@@H]23 |
| InChI | InChI=1S/C17H28O2Si/c1-4-20(5-2,6-3)15-10-9-13-8-7-11-17(18)16(13)14(15)12-19-17/h9-10,13,16,18H,4-8,11-12H2,1-3H3/t13-,16-,17-/m0/s1 |
| InChIKey | DUNSCKRNCBAXBB-JQFCIGGWSA-N |
| XLogP | 4.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|