C18H18Cl2N2S — CID 10133417
8-(2,4-dichlorophenyl)-6-methylsulfanyl-2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indole (PubChem CID 10133417) has the molecular formula C18H18Cl2N2S and a molecular weight of 365.33 g/mol. Its IUPAC name is 8-(2,4-dichlorophenyl)-6-methylsulfanyl-2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indole.
| Compound Name | 8-(2,4-dichlorophenyl)-6-methylsulfanyl-2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 10133417 |
| Molecular Formula | C18H18Cl2N2S |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 8-(2,4-dichlorophenyl)-6-methylsulfanyl-2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indole |
| SMILES | CSc1cc(-c2ccc(Cl)cc2Cl)cc2c1NC1CCNCC21 |
| InChI | InChI=1S/C18H18Cl2N2S/c1-23-17-7-10(12-3-2-11(19)8-15(12)20)6-13-14-9-21-5-4-16(14)22-18(13)17/h2-3,6-8,14,16,21-22H,4-5,9H2,1H3 |
| InChIKey | LRANPAICFTUZGK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |