About 3,5-bis(1-methylcyclopentyl)-1,2,4-oxazaphosphole
3,5-bis(1-methylcyclopentyl)-1,2,4-oxazaphosphole (PubChem CID 101334310) has the molecular formula C14H22NOP
and a molecular weight of 251.31 g/mol. Its IUPAC name is 3,5-bis(1-methylcyclopentyl)-1,2,4-oxazaphosphole.
Molecular Properties
| Compound Name | 3,5-bis(1-methylcyclopentyl)-1,2,4-oxazaphosphole |
| PubChem CID | 101334310 |
| Molecular Formula | C14H22NOP |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 3,5-bis(1-methylcyclopentyl)-1,2,4-oxazaphosphole |
| SMILES | CC1(c2noc(C3(C)CCCC3)p2)CCCC1 |
| InChI | InChI=1S/C14H22NOP/c1-13(7-3-4-8-13)11-15-16-12(17-11)14(2)9-5-6-10-14/h3-10H2,1-2H3 |
| InChIKey | WALQQXYQKSSBSG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-bis(1-methylcyclopentyl)-1,2,4-oxazaphosphole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(1-methylcyclopentyl)-1,2,4-oxazaphosphole?
The IUPAC name of 3,5-bis(1-methylcyclopentyl)-1,2,4-oxazaphosphole (CID 101334310) is 3,5-bis(1-methylcyclopentyl)-1,2,4-oxazaphosphole.
What is the SMILES notation for 3,5-bis(1-methylcyclopentyl)-1,2,4-oxazaphosphole?
The canonical SMILES for 3,5-bis(1-methylcyclopentyl)-1,2,4-oxazaphosphole is CC1(c2noc(C3(C)CCCC3)p2)CCCC1.
What is the InChIKey of 3,5-bis(1-methylcyclopentyl)-1,2,4-oxazaphosphole?
The InChIKey is WALQQXYQKSSBSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22NOP/c1-13(7-3-4-8-13)11-15-16-12(17-11)14(2)9-5-6-10-14/h3-10H2,1-2H3.
What are the key properties of 3,5-bis(1-methylcyclopentyl)-1,2,4-oxazaphosphole?
3,5-bis(1-methylcyclopentyl)-1,2,4-oxazaphosphole has a molecular weight of 251.31 g/mol, XLogP of 4.92, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(1-methylcyclopentyl)-1,2,4-oxazaphosphole is sourced from PubChem (CID 101334310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).