C35H20F6N2S2 — CID 101334609
2-(12,12,13,13,14,14-hexafluoro-1,2-dimethyl-3,23-dithiahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-4(9),5,7,10,15,17,19,21-octaen-6-yl)-1,10-phenanthroline (PubChem CID 101334609) has the molecular formula C35H20F6N2S2 and a molecular weight of 646.68 g/mol. Its IUPAC name is 2-(12,12,13,13,14,14-hexafluoro-1,2-dimethyl-3,23-dithiahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-4(9),5,7,10,15,17,19,21-octaen-6-yl)-1,10-phenanthroline.
| Compound Name | 2-(12,12,13,13,14,14-hexafluoro-1,2-dimethyl-3,23-dithiahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-4(9),5,7,10,15,17,19,21-octaen-6-yl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 101334609 |
| Molecular Formula | C35H20F6N2S2 |
| Molecular Weight | 646.68 g/mol |
| Exact Mass | 646.10 |
| IUPAC Name | 2-(12,12,13,13,14,14-hexafluoro-1,2-dimethyl-3,23-dithiahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-4(9),5,7,10,15,17,19,21-octaen-6-yl)-1,10-phenanthroline |
| SMILES | CC12Sc3ccccc3C1=C1C(=C3c4ccc(-c5ccc6ccc7cccnc7c6n5)cc4SC32C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C35H20F6N2S2/c1-31-25(20-7-3-4-8-23(20)44-31)27-28(34(38,39)35(40,41)33(27,36)37)26-21-13-11-19(16-24(21)45-32(26,31)2)22-14-12-18-10-9-17-6-5-15-42-29(17)30(18)43-22/h3-16H,1-2H3 |
| InChIKey | PICKLTJFEADZJQ-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.68 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|