C56H58O2 — CID 101334756
1-hexoxy-4-[(E)-2-[4-[(E)-2-[4-[4-[(E)-2-[4-[(E)-2-(4-hexoxyphenyl)ethenyl]phenyl]ethenyl]phenyl]phenyl]ethenyl]phenyl]ethenyl]benzene (PubChem CID 101334756) has the molecular formula C56H58O2 and a molecular weight of 763.08 g/mol. Its IUPAC name is 1-hexoxy-4-[(E)-2-[4-[(E)-2-[4-[4-[(E)-2-[4-[(E)-2-(4-hexoxyphenyl)ethenyl]phenyl]ethenyl]phenyl]phenyl]ethenyl]phenyl]ethenyl]benzene.
| Compound Name | 1-hexoxy-4-[(E)-2-[4-[(E)-2-[4-[4-[(E)-2-[4-[(E)-2-(4-hexoxyphenyl)ethenyl]phenyl]ethenyl]phenyl]phenyl]ethenyl]phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 101334756 |
| Molecular Formula | C56H58O2 |
| Molecular Weight | 763.08 g/mol |
| Exact Mass | 762.44 |
| IUPAC Name | 1-hexoxy-4-[(E)-2-[4-[(E)-2-[4-[4-[(E)-2-[4-[(E)-2-(4-hexoxyphenyl)ethenyl]phenyl]ethenyl]phenyl]phenyl]ethenyl]phenyl]ethenyl]benzene |
| SMILES | CCCCCCOc1ccc(/C=C/c2ccc(/C=C/c3ccc(-c4ccc(/C=C/c5ccc(/C=C/c6ccc(OCCCCCC)cc6)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C56H58O2/c1-3-5-7-9-43-57-55-39-31-51(32-40-55)25-21-47-15-11-45(12-16-47)19-23-49-27-35-53(36-28-49)54-37-29-50(30-38-54)24-20-46-13-17-48(18-14-46)22-26-52-33-41-56(42-34-52)58-44-10-8-6-4-2/h11-42H,3-10,43-44H2,1-2H3/b23-19+,24-20+,25-21+,26-22+ |
| InChIKey | CEBFWLAFOVOGDZ-IQDOJDJLSA-N |
| XLogP | 15.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.08 |
| LogP ≤ 5 | 15.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|