About (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)silane
(1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)silane (PubChem CID 101334911) has the molecular formula C11H22Si
and a molecular weight of 182.38 g/mol. Its IUPAC name is (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)silane.
Molecular Properties
| Compound Name | (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)silane |
| PubChem CID | 101334911 |
| Molecular Formula | C11H22Si |
| Molecular Weight | 182.38 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)silane |
| SMILES | CC(C)(C)CC([SiH3])C1CC=CC1 |
| InChI | InChI=1S/C11H22Si/c1-11(2,3)8-10(12)9-6-4-5-7-9/h4-5,9-10H,6-8H2,1-3,12H3 |
| InChIKey | LGLKCOSITRDJFY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)silane?
The IUPAC name of (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)silane (CID 101334911) is (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)silane.
What is the SMILES notation for (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)silane?
The canonical SMILES for (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)silane is CC(C)(C)CC([SiH3])C1CC=CC1.
What is the InChIKey of (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)silane?
The InChIKey is LGLKCOSITRDJFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22Si/c1-11(2,3)8-10(12)9-6-4-5-7-9/h4-5,9-10H,6-8H2,1-3,12H3.
What are the key properties of (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)silane?
(1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)silane has a molecular weight of 182.38 g/mol, XLogP of 2.54, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyclopent-3-en-1-yl-3,3-dimethylbutyl)silane is sourced from PubChem (CID 101334911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).