C20H38N4S — CID 10133531
5-N-cyclohexyl-3-N-decyl-5-N-ethyl-1,2,4-thiadiazole-3,5-diamine (PubChem CID 10133531) has the molecular formula C20H38N4S and a molecular weight of 366.62 g/mol. Its IUPAC name is 5-N-cyclohexyl-3-N-decyl-5-N-ethyl-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 5-N-cyclohexyl-3-N-decyl-5-N-ethyl-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 10133531 |
| Molecular Formula | C20H38N4S |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | 5-N-cyclohexyl-3-N-decyl-5-N-ethyl-1,2,4-thiadiazole-3,5-diamine |
| SMILES | CCCCCCCCCCNc1nsc(N(CC)C2CCCCC2)n1 |
| InChI | InChI=1S/C20H38N4S/c1-3-5-6-7-8-9-10-14-17-21-19-22-20(25-23-19)24(4-2)18-15-12-11-13-16-18/h18H,3-17H2,1-2H3,(H,21,23) |
| InChIKey | KPSZMPVEMUQDNX-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|