C28H26Cl2N2O8S — CID 101335544
(2S)-2-[5-[2-[(2S)-1-chloro-4-methyl-1-oxopentan-2-yl]-1,3-dioxoisoindol-5-yl]sulfonyl-1,3-dioxoisoindol-2-yl]-4-methylpentanoyl chloride (PubChem CID 101335544) has the molecular formula C28H26Cl2N2O8S and a molecular weight of 621.50 g/mol. Its IUPAC name is (2S)-2-[5-[2-[(2S)-1-chloro-4-methyl-1-oxopentan-2-yl]-1,3-dioxoisoindol-5-yl]sulfonyl-1,3-dioxoisoindol-2-yl]-4-methylpentanoyl chloride.
| Compound Name | (2S)-2-[5-[2-[(2S)-1-chloro-4-methyl-1-oxopentan-2-yl]-1,3-dioxoisoindol-5-yl]sulfonyl-1,3-dioxoisoindol-2-yl]-4-methylpentanoyl chloride |
|---|---|
| PubChem CID | 101335544 |
| Molecular Formula | C28H26Cl2N2O8S |
| Molecular Weight | 621.50 g/mol |
| Exact Mass | 620.08 |
| IUPAC Name | (2S)-2-[5-[2-[(2S)-1-chloro-4-methyl-1-oxopentan-2-yl]-1,3-dioxoisoindol-5-yl]sulfonyl-1,3-dioxoisoindol-2-yl]-4-methylpentanoyl chloride |
| SMILES | CC(C)C[C@@H](C(=O)Cl)N1C(=O)c2ccc(S(=O)(=O)c3ccc4c(c3)C(=O)N([C@@H](CC(C)C)C(=O)Cl)C4=O)cc2C1=O |
| InChI | InChI=1S/C28H26Cl2N2O8S/c1-13(2)9-21(23(29)33)31-25(35)17-7-5-15(11-19(17)27(31)37)41(39,40)16-6-8-18-20(12-16)28(38)32(26(18)36)22(24(30)34)10-14(3)4/h5-8,11-14,21-22H,9-10H2,1-4H3/t21-,22-/m0/s1 |
| InChIKey | BLSZQXMTHQYNGQ-VXKWHMMOSA-N |
| XLogP | 4.07 |
| TPSA | 143.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|