C8H12Cl2O4 — CID 101335729
(2R,4aS,6R,8aS)-2,6-bis(chloromethyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine (PubChem CID 101335729) has the molecular formula C8H12Cl2O4 and a molecular weight of 243.09 g/mol. Its IUPAC name is (2R,4aS,6R,8aS)-2,6-bis(chloromethyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine.
| Compound Name | (2R,4aS,6R,8aS)-2,6-bis(chloromethyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine |
|---|---|
| PubChem CID | 101335729 |
| Molecular Formula | C8H12Cl2O4 |
| Molecular Weight | 243.09 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | (2R,4aS,6R,8aS)-2,6-bis(chloromethyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine |
| SMILES | ClC[C@@H]1OC[C@@H]2O[C@H](CCl)OC[C@@H]2O1 |
| InChI | InChI=1S/C8H12Cl2O4/c9-1-7-11-3-6-5(13-7)4-12-8(2-10)14-6/h5-8H,1-4H2/t5-,6-,7+,8+/m0/s1 |
| InChIKey | YMEUZPPDBLXJFY-RULNZFCNSA-N |
| XLogP | 0.95 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.09 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|