C27H29NO7S — CID 101335925
[(1S,11S,13R,15R)-7-hydroxy-9-oxo-11-[(E)-3-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]prop-2-enyl]-10,17-dioxatricyclo[11.3.1.03,8]heptadeca-3(8),4,6-trien-15-yl] acetate (PubChem CID 101335925) has the molecular formula C27H29NO7S and a molecular weight of 511.60 g/mol. Its IUPAC name is [(1S,11S,13R,15R)-7-hydroxy-9-oxo-11-[(E)-3-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]prop-2-enyl]-10,17-dioxatricyclo[11.3.1.03,8]heptadeca-3(8),4,6-trien-15-yl] acetate.
| Compound Name | [(1S,11S,13R,15R)-7-hydroxy-9-oxo-11-[(E)-3-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]prop-2-enyl]-10,17-dioxatricyclo[11.3.1.03,8]heptadeca-3(8),4,6-trien-15-yl] acetate |
|---|---|
| PubChem CID | 101335925 |
| Molecular Formula | C27H29NO7S |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | [(1S,11S,13R,15R)-7-hydroxy-9-oxo-11-[(E)-3-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]prop-2-enyl]-10,17-dioxatricyclo[11.3.1.03,8]heptadeca-3(8),4,6-trien-15-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H]2Cc3cccc(O)c3C(=O)O[C@@H](C/C=C/NC(=O)/C=C/c3cccs3)C[C@H](C1)O2 |
| InChI | InChI=1S/C27H29NO7S/c1-17(29)33-21-15-20-13-18-5-2-8-24(30)26(18)27(32)35-19(14-22(16-21)34-20)6-3-11-28-25(31)10-9-23-7-4-12-36-23/h2-5,7-12,19-22,30H,6,13-16H2,1H3,(H,28,31)/b10-9+,11-3+/t19-,20-,21+,22+/m0/s1 |
| InChIKey | BFTHIRAZVKPIJL-KCUJAWDPSA-N |
| XLogP | 4.14 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|