C42H54O3 — CID 101336165
(1R,2S,4R)-2-[2-[3,5-bis[2-[(1R,2S,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethynyl]phenyl]ethynyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 101336165) has the molecular formula C42H54O3 and a molecular weight of 606.89 g/mol. Its IUPAC name is (1R,2S,4R)-2-[2-[3,5-bis[2-[(1R,2S,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethynyl]phenyl]ethynyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1R,2S,4R)-2-[2-[3,5-bis[2-[(1R,2S,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethynyl]phenyl]ethynyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 101336165 |
| Molecular Formula | C42H54O3 |
| Molecular Weight | 606.89 g/mol |
| Exact Mass | 606.41 |
| IUPAC Name | (1R,2S,4R)-2-[2-[3,5-bis[2-[(1R,2S,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethynyl]phenyl]ethynyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@](O)(C#Cc1cc(C#C[C@@]3(O)C[C@H]4CC[C@]3(C)C4(C)C)cc(C#C[C@@]3(O)C[C@H]4CC[C@]3(C)C4(C)C)c1)C2 |
| InChI | InChI=1S/C42H54O3/c1-34(2)31-13-16-37(34,7)40(43,25-31)19-10-28-22-29(11-20-41(44)26-32-14-17-38(41,8)35(32,3)4)24-30(23-28)12-21-42(45)27-33-15-18-39(42,9)36(33,5)6/h22-24,31-33,43-45H,13-18,25-27H2,1-9H3/t31-,32-,33-,37-,38-,39-,40-,41-,42-/m1/s1 |
| InChIKey | WYFTZQCWAJUAGH-AACVVRRSSA-N |
| XLogP | 7.47 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.89 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|