C18H26NO6S+ — CID 101336550
2-[[(1S)-1-carboxy-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]carbamoyloxy]ethyl-methyl-phenylsulfanium (PubChem CID 101336550) has the molecular formula C18H26NO6S+ and a molecular weight of 384.47 g/mol. Its IUPAC name is 2-[[(1S)-1-carboxy-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]carbamoyloxy]ethyl-methyl-phenylsulfanium.
| Compound Name | 2-[[(1S)-1-carboxy-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]carbamoyloxy]ethyl-methyl-phenylsulfanium |
|---|---|
| PubChem CID | 101336550 |
| Molecular Formula | C18H26NO6S+ |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-[[(1S)-1-carboxy-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]carbamoyloxy]ethyl-methyl-phenylsulfanium |
| SMILES | C[S+](CCOC(=O)N[C@@H](CC(=O)OC(C)(C)C)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C18H25NO6S/c1-18(2,3)25-15(20)12-14(16(21)22)19-17(23)24-10-11-26(4)13-8-6-5-7-9-13/h5-9,14H,10-12H2,1-4H3,(H-,19,21,22,23)/p+1/t14-,26?/m0/s1 |
| InChIKey | VILZNRWZHVAWAZ-BAHZEXJQSA-O |
| XLogP | 2.20 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|