C17H27NO5 — CID 101336854
diethyl (3S)-4-(dimethylcarbamoyl)-3-ethenyl-3-methylcyclopentane-1,1-dicarboxylate (PubChem CID 101336854) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is diethyl (3S)-4-(dimethylcarbamoyl)-3-ethenyl-3-methylcyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl (3S)-4-(dimethylcarbamoyl)-3-ethenyl-3-methylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101336854 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | diethyl (3S)-4-(dimethylcarbamoyl)-3-ethenyl-3-methylcyclopentane-1,1-dicarboxylate |
| SMILES | C=C[C@]1(C)CC(C(=O)OCC)(C(=O)OCC)CC1C(=O)N(C)C |
| InChI | InChI=1S/C17H27NO5/c1-7-16(4)11-17(14(20)22-8-2,15(21)23-9-3)10-12(16)13(19)18(5)6/h7,12H,1,8-11H2,2-6H3/t12?,16-/m1/s1 |
| InChIKey | VJKBXBOGHPSHOC-PVQCJRHBSA-N |
| XLogP | 1.79 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|