C24H23ClN6O5S — CID 101336907
(5R)-5-(acetamidomethyl)-3-(3-amino-4-chlorophenyl)-N-[5-(2-sulfamoylphenyl)-2-pyridinyl]-4H-1,2-oxazole-5-carboxamide (PubChem CID 101336907) has the molecular formula C24H23ClN6O5S and a molecular weight of 543.01 g/mol. Its IUPAC name is (5R)-5-(acetamidomethyl)-3-(3-amino-4-chlorophenyl)-N-[5-(2-sulfamoylphenyl)-2-pyridinyl]-4H-1,2-oxazole-5-carboxamide.
| Compound Name | (5R)-5-(acetamidomethyl)-3-(3-amino-4-chlorophenyl)-N-[5-(2-sulfamoylphenyl)-2-pyridinyl]-4H-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 101336907 |
| Molecular Formula | C24H23ClN6O5S |
| Molecular Weight | 543.01 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | (5R)-5-(acetamidomethyl)-3-(3-amino-4-chlorophenyl)-N-[5-(2-sulfamoylphenyl)-2-pyridinyl]-4H-1,2-oxazole-5-carboxamide |
| SMILES | CC(=O)NC[C@@]1(C(=O)Nc2ccc(-c3ccccc3S(N)(=O)=O)cn2)CC(c2ccc(Cl)c(N)c2)=NO1 |
| InChI | InChI=1S/C24H23ClN6O5S/c1-14(32)29-13-24(11-20(31-36-24)15-6-8-18(25)19(26)10-15)23(33)30-22-9-7-16(12-28-22)17-4-2-3-5-21(17)37(27,34)35/h2-10,12H,11,13,26H2,1H3,(H,29,32)(H2,27,34,35)(H,28,30,33)/t24-/m1/s1 |
| InChIKey | DZADXUOYDHUVHY-XMMPIXPASA-N |
| XLogP | 2.27 |
| TPSA | 178.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.01 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|