C16H20O5 — CID 101336952
(1R,5R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-dimethylspiro[4.4]non-8-ene-2,4,7-trione (PubChem CID 101336952) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is (1R,5R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-dimethylspiro[4.4]non-8-ene-2,4,7-trione.
| Compound Name | (1R,5R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-dimethylspiro[4.4]non-8-ene-2,4,7-trione |
|---|---|
| PubChem CID | 101336952 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (1R,5R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-dimethylspiro[4.4]non-8-ene-2,4,7-trione |
| SMILES | CC1(C)OC[C@@H]([C@@H]2C(=O)C(C)(C)C(=O)[C@]23C=CC(=O)C3)O1 |
| InChI | InChI=1S/C16H20O5/c1-14(2)12(18)11(10-8-20-15(3,4)21-10)16(13(14)19)6-5-9(17)7-16/h5-6,10-11H,7-8H2,1-4H3/t10-,11+,16-/m0/s1 |
| InChIKey | UZSITAYLWJFXHN-USBNGQNGSA-N |
| XLogP | 1.45 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|