C9H14O2S — CID 101337317
(3R,3aS,7aS)-3a-methyl-1-oxo-3,6,7,7a-tetrahydro-2H-1-benzothiophen-3-ol (PubChem CID 101337317) has the molecular formula C9H14O2S and a molecular weight of 186.28 g/mol. Its IUPAC name is (3R,3aS,7aS)-3a-methyl-1-oxo-3,6,7,7a-tetrahydro-2H-1-benzothiophen-3-ol.
| Compound Name | (3R,3aS,7aS)-3a-methyl-1-oxo-3,6,7,7a-tetrahydro-2H-1-benzothiophen-3-ol |
|---|---|
| PubChem CID | 101337317 |
| Molecular Formula | C9H14O2S |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | (3R,3aS,7aS)-3a-methyl-1-oxo-3,6,7,7a-tetrahydro-2H-1-benzothiophen-3-ol |
| SMILES | C[C@@]12C=CCC[C@@H]1S(=O)C[C@@H]2O |
| InChI | InChI=1S/C9H14O2S/c1-9-5-3-2-4-8(9)12(11)6-7(9)10/h3,5,7-8,10H,2,4,6H2,1H3/t7-,8-,9-,12?/m0/s1 |
| InChIKey | GLSUWXUHASTVBY-ITTAVEFGSA-N |
| XLogP | 0.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|