C16H19F6NO2 — CID 10133784
1,1,1,3,3,3-hexafluoro-2-[4-[(Z)-N-propan-2-yloxy-C-propylcarbonimidoyl]phenyl]propan-2-ol (PubChem CID 10133784) has the molecular formula C16H19F6NO2 and a molecular weight of 371.32 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[(Z)-N-propan-2-yloxy-C-propylcarbonimidoyl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[(Z)-N-propan-2-yloxy-C-propylcarbonimidoyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 10133784 |
| Molecular Formula | C16H19F6NO2 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[(Z)-N-propan-2-yloxy-C-propylcarbonimidoyl]phenyl]propan-2-ol |
| SMILES | CCC/C(=N/OC(C)C)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H19F6NO2/c1-4-5-13(23-25-10(2)3)11-6-8-12(9-7-11)14(24,15(17,18)19)16(20,21)22/h6-10,24H,4-5H2,1-3H3/b23-13- |
| InChIKey | GSCUWFFRQCJZDI-QRVIBDJDSA-N |
| XLogP | 4.93 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|