About bis(1,3-dimethyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate
bis(1,3-dimethyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate (PubChem CID 101338952) has the molecular formula C20H22N4O8
and a molecular weight of 446.42 g/mol. Its IUPAC name is bis(1,3-dimethyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate.
Molecular Properties
| Compound Name | bis(1,3-dimethyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate |
| PubChem CID | 101338952 |
| Molecular Formula | C20H22N4O8 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | bis(1,3-dimethyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate |
| SMILES | CC1NN(C)C(=O)C1C(=O)OC(=O)c1ccccc1C(=O)OC(=O)C1C(=O)N(C)NC1C |
| InChI | InChI=1S/C20H22N4O8/c1-9-13(15(25)23(3)21-9)19(29)31-17(27)11-7-5-6-8-12(11)18(28)32-20(30)14-10(2)22-24(4)16(14)26/h5-10,13-14,21-22H,1-4H3 |
| InChIKey | HTVVNXQSMSKXQH-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bis(1,3-dimethyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1,3-dimethyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate?
The IUPAC name of bis(1,3-dimethyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate (CID 101338952) is bis(1,3-dimethyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate.
What is the SMILES notation for bis(1,3-dimethyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate?
The canonical SMILES for bis(1,3-dimethyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate is CC1NN(C)C(=O)C1C(=O)OC(=O)c1ccccc1C(=O)OC(=O)C1C(=O)N(C)NC1C.
What is the InChIKey of bis(1,3-dimethyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate?
The InChIKey is HTVVNXQSMSKXQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O8/c1-9-13(15(25)23(3)21-9)19(29)31-17(27)11-7-5-6-8-12(11)18(28)32-20(30)14-10(2)22-24(4)16(14)26/h5-10,13-14,21-22H,1-4H3.
What are the key properties of bis(1,3-dimethyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate?
bis(1,3-dimethyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate has a molecular weight of 446.42 g/mol, XLogP of -0.98, 4 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1,3-dimethyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate is sourced from PubChem (CID 101338952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).