C19H13ClO6 — CID 10133897
8-chloro-4,7,12-trihydroxy-3-methyl-3,4-dihydro-2H-tetracene-1,6,11-trione (PubChem CID 10133897) has the molecular formula C19H13ClO6 and a molecular weight of 372.76 g/mol. Its IUPAC name is 8-chloro-4,7,12-trihydroxy-3-methyl-3,4-dihydro-2H-tetracene-1,6,11-trione.
| Compound Name | 8-chloro-4,7,12-trihydroxy-3-methyl-3,4-dihydro-2H-tetracene-1,6,11-trione |
|---|---|
| PubChem CID | 10133897 |
| Molecular Formula | C19H13ClO6 |
| Molecular Weight | 372.76 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 8-chloro-4,7,12-trihydroxy-3-methyl-3,4-dihydro-2H-tetracene-1,6,11-trione |
| SMILES | CC1CC(=O)c2c(cc3c(c2O)C(=O)c2ccc(Cl)c(O)c2C3=O)C1O |
| InChI | InChI=1S/C19H13ClO6/c1-6-4-11(21)12-8(15(6)22)5-9-14(19(12)26)16(23)7-2-3-10(20)18(25)13(7)17(9)24/h2-3,5-6,15,22,25-26H,4H2,1H3 |
| InChIKey | VYZRGVNZHYVQDP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.76 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|