C16H32O3Si — CID 101339446
cis-(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,2,5,6-tetramethylcyclohexan-1-one (PubChem CID 101339446) has the molecular formula C16H32O3Si and a molecular weight of 300.52 g/mol. Its IUPAC name is cis-(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,2,5,6-tetramethylcyclohexan-1-one.
| Compound Name | cis-(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,2,5,6-tetramethylcyclohexan-1-one |
|---|---|
| PubChem CID | 101339446 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.52 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | cis-(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,2,5,6-tetramethylcyclohexan-1-one |
| SMILES | CC1C(=O)C(C)(C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@]1(C)O |
| InChI | InChI=1S/C16H32O3Si/c1-11-13(17)15(5,6)12(10-16(11,7)18)19-20(8,9)14(2,3)4/h11-12,18H,10H2,1-9H3/t11?,12-,16-/m0/s1 |
| InChIKey | GSEAIYWJPKHIKV-GAKQDWLJSA-N |
| XLogP | 3.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|