About tert-butyl [(2S,3S)-3-(4-hydroxyhex-5-ynyl)oxiran-2-yl]methyl carbonate
tert-butyl [(2S,3S)-3-(4-hydroxyhex-5-ynyl)oxiran-2-yl]methyl carbonate (PubChem CID 101339987) has the molecular formula C14H22O5
and a molecular weight of 270.32 g/mol. Its IUPAC name is tert-butyl [(2S,3S)-3-(4-hydroxyhex-5-ynyl)oxiran-2-yl]methyl carbonate.
Molecular Properties
| Compound Name | tert-butyl [(2S,3S)-3-(4-hydroxyhex-5-ynyl)oxiran-2-yl]methyl carbonate |
| PubChem CID | 101339987 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | tert-butyl [(2S,3S)-3-(4-hydroxyhex-5-ynyl)oxiran-2-yl]methyl carbonate |
| SMILES | C#CC(O)CCC[C@@H]1O[C@H]1COC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H22O5/c1-5-10(15)7-6-8-11-12(18-11)9-17-13(16)19-14(2,3)4/h1,10-12,15H,6-9H2,2-4H3/t10?,11-,12-/m0/s1 |
| InChIKey | WSXKRLNWZIOBRV-RAMGSTBQSA-N |
| XLogP | 1.87 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl [(2S,3S)-3-(4-hydroxyhex-5-ynyl)oxiran-2-yl]methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl [(2S,3S)-3-(4-hydroxyhex-5-ynyl)oxiran-2-yl]methyl carbonate?
The IUPAC name of tert-butyl [(2S,3S)-3-(4-hydroxyhex-5-ynyl)oxiran-2-yl]methyl carbonate (CID 101339987) is tert-butyl [(2S,3S)-3-(4-hydroxyhex-5-ynyl)oxiran-2-yl]methyl carbonate.
What is the SMILES notation for tert-butyl [(2S,3S)-3-(4-hydroxyhex-5-ynyl)oxiran-2-yl]methyl carbonate?
The canonical SMILES for tert-butyl [(2S,3S)-3-(4-hydroxyhex-5-ynyl)oxiran-2-yl]methyl carbonate is C#CC(O)CCC[C@@H]1O[C@H]1COC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl [(2S,3S)-3-(4-hydroxyhex-5-ynyl)oxiran-2-yl]methyl carbonate?
The InChIKey is WSXKRLNWZIOBRV-RAMGSTBQSA-N. The full InChI is InChI=1S/C14H22O5/c1-5-10(15)7-6-8-11-12(18-11)9-17-13(16)19-14(2,3)4/h1,10-12,15H,6-9H2,2-4H3/t10?,11-,12-/m0/s1.
What are the key properties of tert-butyl [(2S,3S)-3-(4-hydroxyhex-5-ynyl)oxiran-2-yl]methyl carbonate?
tert-butyl [(2S,3S)-3-(4-hydroxyhex-5-ynyl)oxiran-2-yl]methyl carbonate has a molecular weight of 270.32 g/mol, XLogP of 1.87, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl [(2S,3S)-3-(4-hydroxyhex-5-ynyl)oxiran-2-yl]methyl carbonate is sourced from PubChem (CID 101339987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).