C16H22O4 — CID 101340023
(3R,5S,6R)-6-[2-(4-methoxyphenoxy)ethyl]-3,5-dimethyloxan-2-one (PubChem CID 101340023) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (3R,5S,6R)-6-[2-(4-methoxyphenoxy)ethyl]-3,5-dimethyloxan-2-one.
| Compound Name | (3R,5S,6R)-6-[2-(4-methoxyphenoxy)ethyl]-3,5-dimethyloxan-2-one |
|---|---|
| PubChem CID | 101340023 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (3R,5S,6R)-6-[2-(4-methoxyphenoxy)ethyl]-3,5-dimethyloxan-2-one |
| SMILES | COc1ccc(OCC[C@H]2OC(=O)[C@H](C)C[C@@H]2C)cc1 |
| InChI | InChI=1S/C16H22O4/c1-11-10-12(2)16(17)20-15(11)8-9-19-14-6-4-13(18-3)5-7-14/h4-7,11-12,15H,8-10H2,1-3H3/t11-,12+,15+/m0/s1 |
| InChIKey | UCLPWTMNANKMRT-YWPYICTPSA-N |
| XLogP | 3.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |