About (2S)-1-prop-2-enyl-N-(2,2,2-trifluoroethyl)piperazine-2-carboxamide
(2S)-1-prop-2-enyl-N-(2,2,2-trifluoroethyl)piperazine-2-carboxamide (PubChem CID 101340082) has the molecular formula C10H16F3N3O
and a molecular weight of 251.25 g/mol. Its IUPAC name is (2S)-1-prop-2-enyl-N-(2,2,2-trifluoroethyl)piperazine-2-carboxamide.
Molecular Properties
| Compound Name | (2S)-1-prop-2-enyl-N-(2,2,2-trifluoroethyl)piperazine-2-carboxamide |
| PubChem CID | 101340082 |
| Molecular Formula | C10H16F3N3O |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (2S)-1-prop-2-enyl-N-(2,2,2-trifluoroethyl)piperazine-2-carboxamide |
| SMILES | C=CCN1CCNC[C@H]1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C10H16F3N3O/c1-2-4-16-5-3-14-6-8(16)9(17)15-7-10(11,12)13/h2,8,14H,1,3-7H2,(H,15,17)/t8-/m0/s1 |
| InChIKey | VKMOQYXAALPGQD-QMMMGPOBSA-N |
| XLogP | 0.12 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-prop-2-enyl-N-(2,2,2-trifluoroethyl)piperazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-prop-2-enyl-N-(2,2,2-trifluoroethyl)piperazine-2-carboxamide?
The IUPAC name of (2S)-1-prop-2-enyl-N-(2,2,2-trifluoroethyl)piperazine-2-carboxamide (CID 101340082) is (2S)-1-prop-2-enyl-N-(2,2,2-trifluoroethyl)piperazine-2-carboxamide.
What is the SMILES notation for (2S)-1-prop-2-enyl-N-(2,2,2-trifluoroethyl)piperazine-2-carboxamide?
The canonical SMILES for (2S)-1-prop-2-enyl-N-(2,2,2-trifluoroethyl)piperazine-2-carboxamide is C=CCN1CCNC[C@H]1C(=O)NCC(F)(F)F.
What is the InChIKey of (2S)-1-prop-2-enyl-N-(2,2,2-trifluoroethyl)piperazine-2-carboxamide?
The InChIKey is VKMOQYXAALPGQD-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H16F3N3O/c1-2-4-16-5-3-14-6-8(16)9(17)15-7-10(11,12)13/h2,8,14H,1,3-7H2,(H,15,17)/t8-/m0/s1.
What are the key properties of (2S)-1-prop-2-enyl-N-(2,2,2-trifluoroethyl)piperazine-2-carboxamide?
(2S)-1-prop-2-enyl-N-(2,2,2-trifluoroethyl)piperazine-2-carboxamide has a molecular weight of 251.25 g/mol, XLogP of 0.12, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-prop-2-enyl-N-(2,2,2-trifluoroethyl)piperazine-2-carboxamide is sourced from PubChem (CID 101340082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).