C15H24F3N3O3 — CID 101340092
tert-butyl (3S)-4-prop-2-enyl-3-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylate (PubChem CID 101340092) has the molecular formula C15H24F3N3O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is tert-butyl (3S)-4-prop-2-enyl-3-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-prop-2-enyl-3-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 101340092 |
| Molecular Formula | C15H24F3N3O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | tert-butyl (3S)-4-prop-2-enyl-3-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylate |
| SMILES | C=CCN1CCN(C(=O)OC(C)(C)C)C[C@H]1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C15H24F3N3O3/c1-5-6-20-7-8-21(13(23)24-14(2,3)4)9-11(20)12(22)19-10-15(16,17)18/h5,11H,1,6-10H2,2-4H3,(H,19,22)/t11-/m0/s1 |
| InChIKey | FESVBNJBINCIGY-NSHDSACASA-N |
| XLogP | 1.77 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|