C15H25F2NO6 — CID 101340135
[(1S,4S,5S,6R)-7,7-difluoro-4,5,6-trihydroxy-2,2-dimethyl-8-oxocyclooctyl] N,N-diethylcarbamate (PubChem CID 101340135) has the molecular formula C15H25F2NO6 and a molecular weight of 353.36 g/mol. Its IUPAC name is [(1S,4S,5S,6R)-7,7-difluoro-4,5,6-trihydroxy-2,2-dimethyl-8-oxocyclooctyl] N,N-diethylcarbamate.
| Compound Name | [(1S,4S,5S,6R)-7,7-difluoro-4,5,6-trihydroxy-2,2-dimethyl-8-oxocyclooctyl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 101340135 |
| Molecular Formula | C15H25F2NO6 |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | [(1S,4S,5S,6R)-7,7-difluoro-4,5,6-trihydroxy-2,2-dimethyl-8-oxocyclooctyl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)O[C@@H]1C(=O)C(F)(F)[C@H](O)[C@@H](O)[C@@H](O)CC1(C)C |
| InChI | InChI=1S/C15H25F2NO6/c1-5-18(6-2)13(23)24-12-11(22)15(16,17)10(21)9(20)8(19)7-14(12,3)4/h8-10,12,19-21H,5-7H2,1-4H3/t8-,9-,10+,12+/m0/s1 |
| InChIKey | KYMGACYTIUAJGI-UXCLJVHYSA-N |
| XLogP | 0.55 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |