About (2S)-2-naphthalen-2-yl-2,5-dihydrofuran
(2S)-2-naphthalen-2-yl-2,5-dihydrofuran (PubChem CID 101340423) has the molecular formula C14H12O
and a molecular weight of 196.25 g/mol. Its IUPAC name is (2S)-2-naphthalen-2-yl-2,5-dihydrofuran.
Molecular Properties
| Compound Name | (2S)-2-naphthalen-2-yl-2,5-dihydrofuran |
| PubChem CID | 101340423 |
| Molecular Formula | C14H12O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | (2S)-2-naphthalen-2-yl-2,5-dihydrofuran |
| SMILES | C1=C[C@@H](c2ccc3ccccc3c2)OC1 |
| InChI | InChI=1S/C14H12O/c1-2-5-12-10-13(8-7-11(12)4-1)14-6-3-9-15-14/h1-8,10,14H,9H2/t14-/m0/s1 |
| InChIKey | YFIKOLKJBGGNFD-AWEZNQCLSA-N |
| XLogP | 3.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-naphthalen-2-yl-2,5-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-naphthalen-2-yl-2,5-dihydrofuran?
The IUPAC name of (2S)-2-naphthalen-2-yl-2,5-dihydrofuran (CID 101340423) is (2S)-2-naphthalen-2-yl-2,5-dihydrofuran.
What is the SMILES notation for (2S)-2-naphthalen-2-yl-2,5-dihydrofuran?
The canonical SMILES for (2S)-2-naphthalen-2-yl-2,5-dihydrofuran is C1=C[C@@H](c2ccc3ccccc3c2)OC1.
What is the InChIKey of (2S)-2-naphthalen-2-yl-2,5-dihydrofuran?
The InChIKey is YFIKOLKJBGGNFD-AWEZNQCLSA-N. The full InChI is InChI=1S/C14H12O/c1-2-5-12-10-13(8-7-11(12)4-1)14-6-3-9-15-14/h1-8,10,14H,9H2/t14-/m0/s1.
What are the key properties of (2S)-2-naphthalen-2-yl-2,5-dihydrofuran?
(2S)-2-naphthalen-2-yl-2,5-dihydrofuran has a molecular weight of 196.25 g/mol, XLogP of 3.47, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-naphthalen-2-yl-2,5-dihydrofuran is sourced from PubChem (CID 101340423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).