C26H34N2O2 — CID 101340899
[4-[4-[3-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]propoxy]phenyl]phenyl]-pyrrolidin-2-ylmethanone (PubChem CID 101340899) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is [4-[4-[3-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]propoxy]phenyl]phenyl]-pyrrolidin-2-ylmethanone.
| Compound Name | [4-[4-[3-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]propoxy]phenyl]phenyl]-pyrrolidin-2-ylmethanone |
|---|---|
| PubChem CID | 101340899 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | [4-[4-[3-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]propoxy]phenyl]phenyl]-pyrrolidin-2-ylmethanone |
| SMILES | C[C@@H]1CC[C@@H](C)N1CCCOc1ccc(-c2ccc(C(=O)C3CCCN3)cc2)cc1 |
| InChI | InChI=1S/C26H34N2O2/c1-19-6-7-20(2)28(19)17-4-18-30-24-14-12-22(13-15-24)21-8-10-23(11-9-21)26(29)25-5-3-16-27-25/h8-15,19-20,25,27H,3-7,16-18H2,1-2H3/t19-,20-,25?/m1/s1 |
| InChIKey | JSZXAFBOUXWNLB-PRIXLJELSA-N |
| XLogP | 4.93 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|