C16H10F6N2O2 — CID 10134098
(E)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methyl-1,2-oxazol-3-yl]prop-2-enenitrile (PubChem CID 10134098) has the molecular formula C16H10F6N2O2 and a molecular weight of 376.26 g/mol. Its IUPAC name is (E)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methyl-1,2-oxazol-3-yl]prop-2-enenitrile.
| Compound Name | (E)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methyl-1,2-oxazol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 10134098 |
| Molecular Formula | C16H10F6N2O2 |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | (E)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methyl-1,2-oxazol-3-yl]prop-2-enenitrile |
| SMILES | Cc1onc(/C=C/C#N)c1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H10F6N2O2/c1-9-13(12(24-26-9)3-2-8-23)10-4-6-11(7-5-10)14(25,15(17,18)19)16(20,21)22/h2-7,25H,1H3/b3-2+ |
| InChIKey | DUNFVIXDSVWNSQ-NSCUHMNNSA-N |
| XLogP | 4.50 |
| TPSA | 70.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|