About 6-methylidene-5,7-dihydrotetrazolo[5,1-a][2]benzazepine
6-methylidene-5,7-dihydrotetrazolo[5,1-a][2]benzazepine (PubChem CID 101341197) has the molecular formula C11H10N4
and a molecular weight of 198.23 g/mol. Its IUPAC name is 6-methylidene-5,7-dihydrotetrazolo[5,1-a][2]benzazepine.
Molecular Properties
| Compound Name | 6-methylidene-5,7-dihydrotetrazolo[5,1-a][2]benzazepine |
| PubChem CID | 101341197 |
| Molecular Formula | C11H10N4 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 6-methylidene-5,7-dihydrotetrazolo[5,1-a][2]benzazepine |
| SMILES | C=C1Cc2ccccc2-c2nnnn2C1 |
| InChI | InChI=1S/C11H10N4/c1-8-6-9-4-2-3-5-10(9)11-12-13-14-15(11)7-8/h2-5H,1,6-7H2 |
| InChIKey | MBGUMHPZHJKXRV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-methylidene-5,7-dihydrotetrazolo[5,1-a][2]benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylidene-5,7-dihydrotetrazolo[5,1-a][2]benzazepine?
The IUPAC name of 6-methylidene-5,7-dihydrotetrazolo[5,1-a][2]benzazepine (CID 101341197) is 6-methylidene-5,7-dihydrotetrazolo[5,1-a][2]benzazepine.
What is the SMILES notation for 6-methylidene-5,7-dihydrotetrazolo[5,1-a][2]benzazepine?
The canonical SMILES for 6-methylidene-5,7-dihydrotetrazolo[5,1-a][2]benzazepine is C=C1Cc2ccccc2-c2nnnn2C1.
What is the InChIKey of 6-methylidene-5,7-dihydrotetrazolo[5,1-a][2]benzazepine?
The InChIKey is MBGUMHPZHJKXRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4/c1-8-6-9-4-2-3-5-10(9)11-12-13-14-15(11)7-8/h2-5H,1,6-7H2.
What are the key properties of 6-methylidene-5,7-dihydrotetrazolo[5,1-a][2]benzazepine?
6-methylidene-5,7-dihydrotetrazolo[5,1-a][2]benzazepine has a molecular weight of 198.23 g/mol, XLogP of 1.45, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylidene-5,7-dihydrotetrazolo[5,1-a][2]benzazepine is sourced from PubChem (CID 101341197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).