C27H16F5N3O3 — CID 101341236
(2,3,4,5,6-pentafluorophenyl) 2-[2-(2-azido-4-phenylmethoxyphenyl)phenyl]acetate (PubChem CID 101341236) has the molecular formula C27H16F5N3O3 and a molecular weight of 525.43 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-[2-(2-azido-4-phenylmethoxyphenyl)phenyl]acetate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-[2-(2-azido-4-phenylmethoxyphenyl)phenyl]acetate |
|---|---|
| PubChem CID | 101341236 |
| Molecular Formula | C27H16F5N3O3 |
| Molecular Weight | 525.43 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-[2-(2-azido-4-phenylmethoxyphenyl)phenyl]acetate |
| SMILES | [N-]=[N+]=Nc1cc(OCc2ccccc2)ccc1-c1ccccc1CC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C27H16F5N3O3/c28-22-23(29)25(31)27(26(32)24(22)30)38-21(36)12-16-8-4-5-9-18(16)19-11-10-17(13-20(19)34-35-33)37-14-15-6-2-1-3-7-15/h1-11,13H,12,14H2 |
| InChIKey | BNZIQCUACKRWHM-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.43 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|