C11H16O4 — CID 101341258
[(2Z)-2-[(3aR,7aS)-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran-3-ylidene]ethyl] acetate (PubChem CID 101341258) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is [(2Z)-2-[(3aR,7aS)-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran-3-ylidene]ethyl] acetate.
| Compound Name | [(2Z)-2-[(3aR,7aS)-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran-3-ylidene]ethyl] acetate |
|---|---|
| PubChem CID | 101341258 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | [(2Z)-2-[(3aR,7aS)-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran-3-ylidene]ethyl] acetate |
| SMILES | CC(=O)OC/C=C1\CO[C@@H]2OCCC[C@H]12 |
| InChI | InChI=1S/C11H16O4/c1-8(12)13-6-4-9-7-15-11-10(9)3-2-5-14-11/h4,10-11H,2-3,5-7H2,1H3/b9-4+/t10-,11+/m1/s1 |
| InChIKey | GWQSNXFWLCIXTF-BDMRALOESA-N |
| XLogP | 1.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|