C11H19N3O4 — CID 101341687
methyl 2-[(4R,6R)-6-(2-azidoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (PubChem CID 101341687) has the molecular formula C11H19N3O4 and a molecular weight of 257.29 g/mol. Its IUPAC name is methyl 2-[(4R,6R)-6-(2-azidoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate.
| Compound Name | methyl 2-[(4R,6R)-6-(2-azidoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 101341687 |
| Molecular Formula | C11H19N3O4 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | methyl 2-[(4R,6R)-6-(2-azidoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| SMILES | COC(=O)C[C@H]1C[C@@H](CCN=[N+]=[N-])OC(C)(C)O1 |
| InChI | InChI=1S/C11H19N3O4/c1-11(2)17-8(4-5-13-14-12)6-9(18-11)7-10(15)16-3/h8-9H,4-7H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | VGWPAOWVOWMHBG-RKDXNWHRSA-N |
| XLogP | 2.16 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|