C38H52S2 — CID 101341732
2-[3,7-ditert-butyl-5-(3-hexylthiophen-2-yl)naphthalen-1-yl]-3-hexylthiophene (PubChem CID 101341732) has the molecular formula C38H52S2 and a molecular weight of 572.97 g/mol. Its IUPAC name is 2-[3,7-ditert-butyl-5-(3-hexylthiophen-2-yl)naphthalen-1-yl]-3-hexylthiophene.
| Compound Name | 2-[3,7-ditert-butyl-5-(3-hexylthiophen-2-yl)naphthalen-1-yl]-3-hexylthiophene |
|---|---|
| PubChem CID | 101341732 |
| Molecular Formula | C38H52S2 |
| Molecular Weight | 572.97 g/mol |
| Exact Mass | 572.35 |
| IUPAC Name | 2-[3,7-ditert-butyl-5-(3-hexylthiophen-2-yl)naphthalen-1-yl]-3-hexylthiophene |
| SMILES | CCCCCCc1ccsc1-c1cc(C(C)(C)C)cc2c(-c3sccc3CCCCCC)cc(C(C)(C)C)cc12 |
| InChI | InChI=1S/C38H52S2/c1-9-11-13-15-17-27-19-21-39-35(27)33-25-29(37(3,4)5)24-32-31(33)23-30(38(6,7)8)26-34(32)36-28(20-22-40-36)18-16-14-12-10-2/h19-26H,9-18H2,1-8H3 |
| InChIKey | ZXRQWVMRVFZSIT-UHFFFAOYSA-N |
| XLogP | 13.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.97 |
| LogP ≤ 5 | 13.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|