C8H12F2O3 — CID 101341740
(1R,2S)-3,3-difluoro-2-(hydroxymethyl)-1-methylcyclohex-4-ene-1,2-diol (PubChem CID 101341740) has the molecular formula C8H12F2O3 and a molecular weight of 194.18 g/mol. Its IUPAC name is (1R,2S)-3,3-difluoro-2-(hydroxymethyl)-1-methylcyclohex-4-ene-1,2-diol.
| Compound Name | (1R,2S)-3,3-difluoro-2-(hydroxymethyl)-1-methylcyclohex-4-ene-1,2-diol |
|---|---|
| PubChem CID | 101341740 |
| Molecular Formula | C8H12F2O3 |
| Molecular Weight | 194.18 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | (1R,2S)-3,3-difluoro-2-(hydroxymethyl)-1-methylcyclohex-4-ene-1,2-diol |
| SMILES | C[C@@]1(O)CC=CC(F)(F)[C@]1(O)CO |
| InChI | InChI=1S/C8H12F2O3/c1-6(12)3-2-4-8(9,10)7(6,13)5-11/h2,4,11-13H,3,5H2,1H3/t6-,7+/m1/s1 |
| InChIKey | QCHHOVAHXOCWSB-RQJHMYQMSA-N |
| XLogP | 0.06 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.18 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|