About 1-methoxy-6,8-dimethyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-ol
1-methoxy-6,8-dimethyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-ol (PubChem CID 101341945) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is 1-methoxy-6,8-dimethyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-ol.
Molecular Properties
| Compound Name | 1-methoxy-6,8-dimethyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-ol |
| PubChem CID | 101341945 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 1-methoxy-6,8-dimethyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-ol |
| SMILES | COC12OCC3(C)CC1(C)C(O)C=CC32 |
| InChI | InChI=1S/C12H18O3/c1-10-6-11(2)9(13)5-4-8(10)12(11,14-3)15-7-10/h4-5,8-9,13H,6-7H2,1-3H3 |
| InChIKey | MAQXKKRZPXZFGY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-6,8-dimethyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-6,8-dimethyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-ol?
The IUPAC name of 1-methoxy-6,8-dimethyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-ol (CID 101341945) is 1-methoxy-6,8-dimethyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-ol.
What is the SMILES notation for 1-methoxy-6,8-dimethyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-ol?
The canonical SMILES for 1-methoxy-6,8-dimethyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-ol is COC12OCC3(C)CC1(C)C(O)C=CC32.
What is the InChIKey of 1-methoxy-6,8-dimethyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-ol?
The InChIKey is MAQXKKRZPXZFGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3/c1-10-6-11(2)9(13)5-4-8(10)12(11,14-3)15-7-10/h4-5,8-9,13H,6-7H2,1-3H3.
What are the key properties of 1-methoxy-6,8-dimethyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-ol?
1-methoxy-6,8-dimethyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-ol has a molecular weight of 210.27 g/mol, XLogP of 1.32, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-6,8-dimethyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-ol is sourced from PubChem (CID 101341945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).