C19H12F7N3O2 — CID 101342302
2-[[3-(1,1,2,2,3,3,3-heptafluoropropyl)-1-phenylpyrazol-5-yl]amino]benzoic acid (PubChem CID 101342302) has the molecular formula C19H12F7N3O2 and a molecular weight of 447.31 g/mol. Its IUPAC name is 2-[[3-(1,1,2,2,3,3,3-heptafluoropropyl)-1-phenylpyrazol-5-yl]amino]benzoic acid.
| Compound Name | 2-[[3-(1,1,2,2,3,3,3-heptafluoropropyl)-1-phenylpyrazol-5-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 101342302 |
| Molecular Formula | C19H12F7N3O2 |
| Molecular Weight | 447.31 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 2-[[3-(1,1,2,2,3,3,3-heptafluoropropyl)-1-phenylpyrazol-5-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccccc1Nc1cc(C(F)(F)C(F)(F)C(F)(F)F)nn1-c1ccccc1 |
| InChI | InChI=1S/C19H12F7N3O2/c20-17(21,18(22,23)19(24,25)26)14-10-15(29(28-14)11-6-2-1-3-7-11)27-13-9-5-4-8-12(13)16(30)31/h1-10,27H,(H,30,31) |
| InChIKey | GBYSYHQBDJZYAT-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.31 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|