C19H26Si — CID 101342555
trimethyl-[(E)-6-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)hex-3-en-1,5-diynyl]silane (PubChem CID 101342555) has the molecular formula C19H26Si and a molecular weight of 282.50 g/mol. Its IUPAC name is trimethyl-[(E)-6-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)hex-3-en-1,5-diynyl]silane.
| Compound Name | trimethyl-[(E)-6-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)hex-3-en-1,5-diynyl]silane |
|---|---|
| PubChem CID | 101342555 |
| Molecular Formula | C19H26Si |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | trimethyl-[(E)-6-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)hex-3-en-1,5-diynyl]silane |
| SMILES | CC1=C(C)C(C)(C#C/C=C/C#C[Si](C)(C)C)C(C)=C1C |
| InChI | InChI=1S/C19H26Si/c1-15-16(2)18(4)19(5,17(15)3)13-11-9-10-12-14-20(6,7)8/h9-10H,1-8H3/b10-9+ |
| InChIKey | IKOHHKNRHSBQBV-MDZDMXLPSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|