About [(2S,3S)-3-(methoxymethyl)oxiran-2-yl]-dimethyl-phenylsilane
[(2S,3S)-3-(methoxymethyl)oxiran-2-yl]-dimethyl-phenylsilane (PubChem CID 101342643) has the molecular formula C12H18O2Si
and a molecular weight of 222.36 g/mol. Its IUPAC name is [(2S,3S)-3-(methoxymethyl)oxiran-2-yl]-dimethyl-phenylsilane.
Molecular Properties
| Compound Name | [(2S,3S)-3-(methoxymethyl)oxiran-2-yl]-dimethyl-phenylsilane |
| PubChem CID | 101342643 |
| Molecular Formula | C12H18O2Si |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | [(2S,3S)-3-(methoxymethyl)oxiran-2-yl]-dimethyl-phenylsilane |
| SMILES | COC[C@@H]1O[C@H]1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C12H18O2Si/c1-13-9-11-12(14-11)15(2,3)10-7-5-4-6-8-10/h4-8,11-12H,9H2,1-3H3/t11-,12-/m0/s1 |
| InChIKey | XDBHQBPZNMEAOL-RYUDHWBXSA-N |
| XLogP | 1.55 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3S)-3-(methoxymethyl)oxiran-2-yl]-dimethyl-phenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S)-3-(methoxymethyl)oxiran-2-yl]-dimethyl-phenylsilane?
The IUPAC name of [(2S,3S)-3-(methoxymethyl)oxiran-2-yl]-dimethyl-phenylsilane (CID 101342643) is [(2S,3S)-3-(methoxymethyl)oxiran-2-yl]-dimethyl-phenylsilane.
What is the SMILES notation for [(2S,3S)-3-(methoxymethyl)oxiran-2-yl]-dimethyl-phenylsilane?
The canonical SMILES for [(2S,3S)-3-(methoxymethyl)oxiran-2-yl]-dimethyl-phenylsilane is COC[C@@H]1O[C@H]1[Si](C)(C)c1ccccc1.
What is the InChIKey of [(2S,3S)-3-(methoxymethyl)oxiran-2-yl]-dimethyl-phenylsilane?
The InChIKey is XDBHQBPZNMEAOL-RYUDHWBXSA-N. The full InChI is InChI=1S/C12H18O2Si/c1-13-9-11-12(14-11)15(2,3)10-7-5-4-6-8-10/h4-8,11-12H,9H2,1-3H3/t11-,12-/m0/s1.
What are the key properties of [(2S,3S)-3-(methoxymethyl)oxiran-2-yl]-dimethyl-phenylsilane?
[(2S,3S)-3-(methoxymethyl)oxiran-2-yl]-dimethyl-phenylsilane has a molecular weight of 222.36 g/mol, XLogP of 1.55, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S)-3-(methoxymethyl)oxiran-2-yl]-dimethyl-phenylsilane is sourced from PubChem (CID 101342643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).